![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | libdaemon-control-perl/ | 2019-02-27 01:24 | - | |
![[DIR]](/icons/folder.gif) | libdaemon-generic-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdancer-logger-psgi-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdancer-logger-syslog-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdancer-perl/ | 2023-02-19 19:33 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-auth-extensible-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-catmandu-oai-perl/ | 2023-02-05 05:09 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-database-core-perl/ | 2024-10-26 17:34 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-database-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-dbic-perl/ | 2024-01-22 00:41 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-email-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-flashmessage-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdancer-plugin-rest-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdancer-session-cookie-perl/ | 2023-01-06 01:00 | - | |
![[DIR]](/icons/folder.gif) | libdancer-session-memcached-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdancer2-perl/ | 2024-12-08 07:32 | - | |
![[DIR]](/icons/folder.gif) | libdancer2-plugin-ajax-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdancer2-plugin-database-perl/ | 2023-06-14 01:35 | - | |
![[DIR]](/icons/folder.gif) | libdancer2-plugin-passphrase-perl/ | 2022-06-01 02:21 | - | |
![[DIR]](/icons/folder.gif) | libdancer2-session-cookie-perl/ | 2025-03-07 10:28 | - | |
![[DIR]](/icons/folder.gif) | libdanga-socket-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdansguardian-perl/ | 2024-07-23 02:22 | - | |
![[DIR]](/icons/folder.gif) | libdap/ | 2025-01-20 14:15 | - | |
![[DIR]](/icons/folder.gif) | libdata-alias-perl/ | 2024-10-21 10:51 | - | |
![[DIR]](/icons/folder.gif) | libdata-amf-perl/ | 2016-12-05 00:23 | - | |
![[DIR]](/icons/folder.gif) | libdata-binary-perl/ | 2022-12-05 00:30 | - | |
![[DIR]](/icons/folder.gif) | libdata-bitmask-perl/ | 2024-10-31 21:59 | - | |
![[DIR]](/icons/folder.gif) | libdata-buffer-perl/ | 2024-11-16 07:01 | - | |
![[DIR]](/icons/folder.gif) | libdata-checks-perl/ | 2024-11-02 07:14 | - | |
![[DIR]](/icons/folder.gif) | libdata-clone-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdata-compactreadonly-perl/ | 2023-11-02 01:40 | - | |
![[DIR]](/icons/folder.gif) | libdata-compare-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-dmp-perl/ | 2022-11-25 07:36 | - | |
![[DIR]](/icons/folder.gif) | libdata-downsample-largesttrianglethreebuckets-perl/ | 2021-01-14 13:22 | - | |
![[DIR]](/icons/folder.gif) | libdata-dpath-perl/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdata-dump-oneline-perl/ | 2022-12-08 12:30 | - | |
![[DIR]](/icons/folder.gif) | libdata-dump-perl/ | 2016-11-01 09:14 | - | |
![[DIR]](/icons/folder.gif) | libdata-dump-streamer-perl/ | 2024-10-21 07:16 | - | |
![[DIR]](/icons/folder.gif) | libdata-dumper-compact-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-dumper-concise-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-dumper-simple-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-dumpxml-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-entropy-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-fake-perl/ | 2024-07-26 09:18 | - | |
![[DIR]](/icons/folder.gif) | libdata-faker-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-find-perl/ | 2024-10-31 21:59 | - | |
![[DIR]](/icons/folder.gif) | libdata-float-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-flow-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-format-html-perl/ | 2023-10-27 00:13 | - | |
![[DIR]](/icons/folder.gif) | libdata-formvalidator-constraints-datetime-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-formvalidator-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-guid-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-hal-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-hexdump-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-hexdumper-perl/ | 2021-01-05 18:41 | - | |
![[DIR]](/icons/folder.gif) | libdata-ical-datetime-perl/ | 2024-10-31 21:59 | - | |
![[DIR]](/icons/folder.gif) | libdata-ical-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-ieee754-perl/ | 2022-12-03 00:29 | - | |
![[DIR]](/icons/folder.gif) | libdata-integer-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-javascript-anon-perl/ | 2024-12-03 01:28 | - | |
![[DIR]](/icons/folder.gif) | libdata-javascript-perl/ | 2020-10-29 00:18 | - | |
![[DIR]](/icons/folder.gif) | libdata-messagepack-perl/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdata-messagepack-stream-perl/ | 2024-10-21 00:39 | - | |
![[DIR]](/icons/folder.gif) | libdata-methodproxy-perl/ | 2019-09-08 18:43 | - | |
![[DIR]](/icons/folder.gif) | libdata-miscellany-perl/ | 2022-12-05 00:30 | - | |
![[DIR]](/icons/folder.gif) | libdata-munge-perl/ | 2024-07-30 15:08 | - | |
![[DIR]](/icons/folder.gif) | libdata-objectdriver-perl/ | 2024-10-31 21:59 | - | |
![[DIR]](/icons/folder.gif) | libdata-optlist-perl/ | 2016-11-01 02:13 | - | |
![[DIR]](/icons/folder.gif) | libdata-page-pageset-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-page-perl/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdata-pageset-perl/ | 2021-01-04 00:43 | - | |
![[DIR]](/icons/folder.gif) | libdata-paginator-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-parsebinary-perl/ | 2024-03-05 18:48 | - | |
![[DIR]](/icons/folder.gif) | libdata-password-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-password-zxcvbn-perl/ | 2023-05-02 03:52 | - | |
![[DIR]](/icons/folder.gif) | libdata-peek-perl/ | 2025-01-19 08:00 | - | |
![[DIR]](/icons/folder.gif) | libdata-perl-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-phrasebook-loader-yaml-perl/ | 2022-06-13 07:25 | - | |
![[DIR]](/icons/folder.gif) | libdata-phrasebook-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-pond-perl/ | 2024-10-21 07:16 | - | |
![[DIR]](/icons/folder.gif) | libdata-printer-perl/ | 2024-05-03 05:30 | - | |
![[DIR]](/icons/folder.gif) | libdata-random-perl/ | 2018-07-21 01:18 | - | |
![[DIR]](/icons/folder.gif) | libdata-record-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-report-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-rmap-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-sah-normalize-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-section-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-section-simple-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-serializer-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-serializer-sereal-perl/ | 2022-12-11 07:11 | - | |
![[DIR]](/icons/folder.gif) | libdata-session-perl/ | 2023-02-16 07:36 | - | |
![[DIR]](/icons/folder.gif) | libdata-show-perl/ | 2024-11-01 13:33 | - | |
![[DIR]](/icons/folder.gif) | libdata-showtable-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-sorting-perl/ | 2022-11-21 18:40 | - | |
![[DIR]](/icons/folder.gif) | libdata-stag-perl/ | 2022-06-13 07:48 | - | |
![[DIR]](/icons/folder.gif) | libdata-stream-bulk-perl/ | 2021-01-02 07:13 | - | |
![[DIR]](/icons/folder.gif) | libdata-streamdeserializer-perl/ | 2025-01-12 01:50 | - | |
![[DIR]](/icons/folder.gif) | libdata-streamserializer-perl/ | 2025-02-06 14:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-structure-util-perl/ | 2024-10-20 12:24 | - | |
![[DIR]](/icons/folder.gif) | libdata-swap-perl/ | 2024-10-20 11:47 | - | |
![[DIR]](/icons/folder.gif) | libdata-table-perl/ | 2022-11-25 19:31 | - | |
![[DIR]](/icons/folder.gif) | libdata-tablereader-perl/ | 2024-06-23 20:48 | - | |
![[DIR]](/icons/folder.gif) | libdata-transformer-perl/ | 2022-11-22 00:50 | - | |
![[DIR]](/icons/folder.gif) | libdata-treedumper-oo-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdata-treedumper-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-treedumper-renderer-dhtml-perl/ | 2022-11-20 19:05 | - | |
![[DIR]](/icons/folder.gif) | libdata-treedumper-renderer-gtk-perl/ | 2017-11-02 21:52 | - | |
![[DIR]](/icons/folder.gif) | libdata-types-perl/ | 2020-07-13 10:50 | - | |
![[DIR]](/icons/folder.gif) | libdata-uniqid-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-uriencode-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdata-url-java/ | 2019-11-25 19:24 | - | |
![[DIR]](/icons/folder.gif) | libdata-util-perl/ | 2024-10-20 19:09 | - | |
![[DIR]](/icons/folder.gif) | libdata-uuid-libuuid-perl/ | 2024-10-20 19:44 | - | |
![[DIR]](/icons/folder.gif) | libdata-uuid-mt-perl/ | 2023-02-10 01:38 | - | |
![[DIR]](/icons/folder.gif) | libdata-uuid-perl/ | 2024-10-20 11:47 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-domain-perl/ | 2020-07-07 15:03 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-email-perl/ | 2018-07-23 01:18 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-ip-perl/ | 2022-03-04 11:09 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-perl/ | 2024-03-06 00:33 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-struct-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-type-perl/ | 2023-02-05 15:54 | - | |
![[DIR]](/icons/folder.gif) | libdata-validate-uri-perl/ | 2022-03-04 11:09 | - | |
![[DIR]](/icons/folder.gif) | libdata-visitor-perl/ | 2023-10-27 00:13 | - | |
![[DIR]](/icons/folder.gif) | libdata-walk-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdata-yaml-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdatabase-dumptruck-perl/ | 2023-08-02 07:42 | - | |
![[DIR]](/icons/folder.gif) | libdatapager-perl/ | 2025-03-09 08:33 | - | |
![[DIR]](/icons/folder.gif) | libdate-calc-perl/ | 2022-06-13 13:23 | - | |
![[DIR]](/icons/folder.gif) | libdate-calc-xs-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdate-convert-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdate-extract-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdate-hijri-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdate-holidays-de-perl/ | 2023-02-19 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdate-iso8601-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdate-jd-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdate-leapyear-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdate-pcalc-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdate-pregnancy-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdate-range-perl/ | 2022-11-06 08:54 | - | |
![[DIR]](/icons/folder.gif) | libdate-simple-perl/ | 2024-10-20 11:47 | - | |
![[DIR]](/icons/folder.gif) | libdate-tiny-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-astro-sunrise-perl/ | 2016-10-31 14:25 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-calendar-discordian-perl/ | 2021-01-07 06:18 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-calendar-julian-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-event-cron-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-event-ical-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-event-recurrence-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-event-sunrise-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-builder-perl/ | 2020-08-12 01:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-datemanip-perl/ | 2022-08-17 13:19 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-dateparse-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-db2-perl/ | 2025-03-09 08:33 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-dbi-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-duration-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-epoch-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-flexible-perl/ | 2025-01-12 19:44 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-http-perl/ | 2024-11-16 07:01 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-human-duration-perl/ | 2022-06-13 13:23 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-ical-perl/ | 2022-06-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-iso8601-perl/ | 2025-03-01 21:22 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-mail-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-mysql-perl/ | 2023-10-27 00:13 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-natural-perl/ | 2025-01-11 08:13 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-oracle-perl/ | 2021-01-05 01:05 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-pg-perl/ | 2021-10-19 04:29 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-rfc3339-perl/ | 2025-01-11 08:13 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-sqlite-perl/ | 2022-06-13 13:23 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-strptime-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-w3cdtf-perl/ | 2020-12-23 00:40 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-format-xsd-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-hires-perl/ | 2023-01-25 02:11 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-incomplete-perl/ | 2024-03-06 00:33 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-locale-perl/ | 2024-05-03 05:30 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-perl/ | 2024-10-20 19:44 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-set-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-timezone-perl/ | 2025-01-22 01:49 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-timezone-systemv-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-timezone-tzfile-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdatetime-tiny-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdatetimex-auto-perl/ | 2022-11-21 00:51 | - | |
![[DIR]](/icons/folder.gif) | libdatetimex-easy-perl/ | 2025-01-20 01:46 | - | |
![[DIR]](/icons/folder.gif) | libdatrie/ | 2024-04-17 20:53 | - | |
![[DIR]](/icons/folder.gif) | libdazzle/ | 2025-02-07 20:05 | - | |
![[DIR]](/icons/folder.gif) | libdb-file-lock-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdb-je-java/ | 2025-02-04 07:32 | - | |
![[DIR]](/icons/folder.gif) | libdbd-cassandra-perl/ | 2023-07-27 20:28 | - | |
![[DIR]](/icons/folder.gif) | libdbd-csv-perl/ | 2025-02-01 07:22 | - | |
![[DIR]](/icons/folder.gif) | libdbd-excel-perl/ | 2024-02-18 06:24 | - | |
![[DIR]](/icons/folder.gif) | libdbd-firebird-perl/ | 2025-02-23 01:55 | - | |
![[DIR]](/icons/folder.gif) | libdbd-ldap-perl/ | 2021-01-03 18:46 | - | |
![[DIR]](/icons/folder.gif) | libdbd-mariadb-perl/ | 2024-10-20 18:04 | - | |
![[DIR]](/icons/folder.gif) | libdbd-mock-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdbd-multi-perl/ | 2024-01-14 02:04 | - | |
![[DIR]](/icons/folder.gif) | libdbd-mysql-perl/ | 2025-02-24 01:54 | - | |
![[DIR]](/icons/folder.gif) | libdbd-odbc-perl/ | 2024-10-21 01:14 | - | |
![[DIR]](/icons/folder.gif) | libdbd-pg-perl/ | 2024-10-21 07:16 | - | |
![[DIR]](/icons/folder.gif) | libdbd-sqlite2-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdbd-sqlite3-perl/ | 2024-11-18 13:54 | - | |
![[DIR]](/icons/folder.gif) | libdbd-sybase-perl/ | 2025-02-05 19:52 | - | |
![[DIR]](/icons/folder.gif) | libdbd-xbase-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbg/ | 2020-04-03 04:08 | - | |
![[DIR]](/icons/folder.gif) | libdbi-test-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdbi/ | 2024-04-07 00:04 | - | |
![[DIR]](/icons/folder.gif) | libdbicx-sugar-perl/ | 2022-11-20 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdbicx-testdatabase-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-abstract-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdbix-admin-createtable-perl/ | 2023-01-25 02:11 | - | |
![[DIR]](/icons/folder.gif) | libdbix-bulkloader-mysql-perl/ | 2023-02-16 07:36 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-candy-perl/ | 2024-11-16 07:01 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-cursor-cached-perl/ | 2024-03-05 18:48 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-datetime-epoch-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-deploymenthandler-perl/ | 2024-07-29 08:11 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-dynamicdefault-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-encodedcolumn-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-factory-perl/ | 2023-02-16 07:36 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-helpers-perl/ | 2024-11-16 07:01 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-htmlwidget-perl/ | 2024-12-01 15:39 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-inflatecolumn-fs-perl/ | 2021-01-08 00:53 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-inflatecolumn-ip-perl/ | 2024-02-22 00:27 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-inflatecolumn-serializer-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-introspectablem2m-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-optimisticlocking-perl/ | 2022-05-28 19:59 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-perl/ | 2025-02-01 07:22 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-resultset-recursiveupdate-perl/ | 2025-02-01 07:22 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-schema-config-perl/ | 2022-04-30 05:40 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-schema-loader-perl/ | 2024-01-21 00:35 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-schema-populatemore-perl/ | 2023-01-25 02:11 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-timestamp-perl/ | 2024-03-06 00:33 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-tree-nestedset-perl/ | 2021-01-06 00:56 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-tree-perl/ | 2023-02-16 07:36 | - | |
![[DIR]](/icons/folder.gif) | libdbix-class-uuidcolumns-perl/ | 2021-01-07 01:26 | - | |
![[DIR]](/icons/folder.gif) | libdbix-connector-perl/ | 2024-10-31 21:58 | - | |
![[DIR]](/icons/folder.gif) | libdbix-contextualfetch-perl/ | 2022-12-07 01:03 | - | |
![[DIR]](/icons/folder.gif) | libdbix-datasource-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-dbschema-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdbix-dbstag-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdbix-dr-perl/ | 2022-04-30 05:40 | - | |
![[DIR]](/icons/folder.gif) | libdbix-fulltextsearch-perl/ | 2018-05-05 02:05 | - | |
![[DIR]](/icons/folder.gif) | libdbix-introspector-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-multistatementdo-perl/ | 2022-11-06 05:03 | - | |
![[DIR]](/icons/folder.gif) | libdbix-oo-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-password-perl/ | 2022-12-05 06:39 | - | |
![[DIR]](/icons/folder.gif) | libdbix-profile-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdbix-recordset-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-runsql-perl/ | 2024-10-31 21:58 | - | |
![[DIR]](/icons/folder.gif) | libdbix-safe-perl/ | 2024-03-05 06:38 | - | |
![[DIR]](/icons/folder.gif) | libdbix-searchbuilder-perl/ | 2024-05-16 01:50 | - | |
![[DIR]](/icons/folder.gif) | libdbix-sequence-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdbix-simple-perl/ | 2023-10-27 00:12 | - | |
![[DIR]](/icons/folder.gif) | libdbix-xml-rdb-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbix-xmlmessage-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdbm-deep-perl/ | 2024-01-13 08:20 | - | |
![[DIR]](/icons/folder.gif) | libdbusmenu-lxqt/ | 2025-02-23 08:03 | - | |
![[DIR]](/icons/folder.gif) | libdbusmenu-qt/ | 2024-05-09 15:19 | - | |
![[DIR]](/icons/folder.gif) | libdbusmenu/ | 2024-12-20 05:00 | - | |
![[DIR]](/icons/folder.gif) | libdc0/ | 2017-04-11 14:18 | - | |
![[DIR]](/icons/folder.gif) | libdc1394-22/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdc1394/ | 2024-04-19 00:28 | - | |
![[DIR]](/icons/folder.gif) | libdca/ | 2024-04-19 00:28 | - | |
![[DIR]](/icons/folder.gif) | libde265/ | 2025-02-26 21:45 | - | |
![[DIR]](/icons/folder.gif) | libdebian-copyright-perl/ | 2024-01-11 02:10 | - | Debian APT repository (oldstable, stable, testing, unstable, experimental, lts, backports) |
![[DIR]](/icons/folder.gif) | libdebian-dep12-perl/ | 2024-10-26 23:10 | - | Debian APT repository (oldstable, stable, testing, unstable, experimental, lts, backports) |
![[DIR]](/icons/folder.gif) | libdebian-installer/ | 2021-12-23 07:20 | - | Debian APT repository (oldstable, stable, testing, unstable, experimental, lts, backports) |
![[DIR]](/icons/folder.gif) | libdebian-package-html-perl/ | 2022-01-26 18:29 | - | Debian APT repository (oldstable, stable, testing, unstable, experimental, lts, backports) |
![[DIR]](/icons/folder.gif) | libdebug-client-perl/ | 2018-01-22 09:49 | - | |
![[DIR]](/icons/folder.gif) | libdebug-trace-perl/ | 2018-05-05 02:05 | - | |
![[DIR]](/icons/folder.gif) | libdebug/ | 2024-06-30 02:25 | - | |
![[DIR]](/icons/folder.gif) | libdecaf/ | 2024-04-22 12:51 | - | |
![[DIR]](/icons/folder.gif) | libdecentxml-java/ | 2025-02-04 07:32 | - | |
![[DIR]](/icons/folder.gif) | libdeclare-constraints-simple-perl/ | 2021-01-10 00:42 | - | |
![[DIR]](/icons/folder.gif) | libdecodeqr/ | 2018-01-23 10:03 | - | |
![[DIR]](/icons/folder.gif) | libdecor-0/ | 2024-11-20 02:12 | - | |
![[DIR]](/icons/folder.gif) | libdefhash-perl/ | 2022-11-30 01:38 | - | |
![[DIR]](/icons/folder.gif) | libdeflate/ | 2025-01-18 19:48 | - | |
![[DIR]](/icons/folder.gif) | libdesktop-agnostic/ | 2018-01-19 10:25 | - | |
![[DIR]](/icons/folder.gif) | libdesktop-notify-perl/ | 2018-11-09 11:54 | - | |
![[DIR]](/icons/folder.gif) | libdessert0.87/ | 2015-12-05 03:22 | - | |
![[DIR]](/icons/folder.gif) | libdevel-argnames-perl/ | 2022-12-07 01:03 | - | |
![[DIR]](/icons/folder.gif) | libdevel-autoflush-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-backtrace-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdevel-beginlift-perl/ | 2018-01-22 19:17 | - | |
![[DIR]](/icons/folder.gif) | libdevel-bt-perl/ | 2025-01-22 08:04 | - | |
![[DIR]](/icons/folder.gif) | libdevel-callchecker-perl/ | 2018-06-22 17:13 | - | |
![[DIR]](/icons/folder.gif) | libdevel-caller-ignorenamespaces-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-caller-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdevel-callparser-perl/ | 2024-12-09 19:59 | - | |
![[DIR]](/icons/folder.gif) | libdevel-callsite-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdevel-calltrace-perl/ | 2022-12-05 00:30 | - | |
![[DIR]](/icons/folder.gif) | libdevel-checkbin-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-checkcompiler-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-checklib-perl/ | 2022-05-08 01:44 | - | |
![[DIR]](/icons/folder.gif) | libdevel-confess-perl/ | 2024-10-26 17:34 | - | |
![[DIR]](/icons/folder.gif) | libdevel-cover-perl/ | 2025-02-23 01:55 | - | |
![[DIR]](/icons/folder.gif) | libdevel-cover-report-clover-perl/ | 2024-03-06 00:33 | - | |
![[DIR]](/icons/folder.gif) | libdevel-cycle-perl/ | 2022-12-07 06:47 | - | |
![[DIR]](/icons/folder.gif) | libdevel-declare-parser-perl/ | 2023-10-27 08:53 | - | |
![[DIR]](/icons/folder.gif) | libdevel-declare-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdevel-dprof-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdevel-dumpvar-perl/ | 2021-01-05 01:05 | - | |
![[DIR]](/icons/folder.gif) | libdevel-ebug-perl/ | 2016-11-01 02:13 | - | |
![[DIR]](/icons/folder.gif) | libdevel-findperl-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-findref-perl/ | 2018-01-22 09:49 | - | |
![[DIR]](/icons/folder.gif) | libdevel-gdb-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-globaldestruction-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-hide-perl/ | 2022-11-06 05:03 | - | |
![[DIR]](/icons/folder.gif) | libdevel-leak-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdevel-lexalias-perl/ | 2024-10-21 05:49 | - | |
![[DIR]](/icons/folder.gif) | libdevel-mat-dumper-perl/ | 2025-02-23 01:55 | - | |
![[DIR]](/icons/folder.gif) | libdevel-mat-perl/ | 2024-10-21 05:49 | - | |
![[DIR]](/icons/folder.gif) | libdevel-nytprof-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdevel-overloadinfo-perl/ | 2021-10-19 04:29 | - | |
![[DIR]](/icons/folder.gif) | libdevel-overrideglobalrequire-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-partialdump-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdevel-patchperl-perl/ | 2021-12-23 03:58 | - | |
![[DIR]](/icons/folder.gif) | libdevel-pragma-perl/ | 2024-10-21 01:48 | - | |
![[DIR]](/icons/folder.gif) | libdevel-profile-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-ptkdb-perl/ | 2021-01-05 01:05 | - | |
![[DIR]](/icons/folder.gif) | libdevel-refactor-perl/ | 2022-11-21 18:40 | - | |
![[DIR]](/icons/folder.gif) | libdevel-refcount-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdevel-repl-perl/ | 2022-06-04 01:24 | - | |
![[DIR]](/icons/folder.gif) | libdevel-simpletrace-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-size-perl/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdevel-stacktrace-ashtml-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdevel-stacktrace-perl/ | 2020-07-10 23:52 | - | |
![[DIR]](/icons/folder.gif) | libdevel-stacktrace-withlexicals-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdevel-strictmode-perl/ | 2024-03-05 18:48 | - | |
![[DIR]](/icons/folder.gif) | libdevel-trace-perl/ | 2021-01-05 01:05 | - | |
![[DIR]](/icons/folder.gif) | libdevice-cdio-perl/ | 2025-02-06 14:02 | - | |
![[DIR]](/icons/folder.gif) | libdevice-gsm-perl/ | 2021-01-21 07:16 | - | |
![[DIR]](/icons/folder.gif) | libdevice-i2c-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdevice-modem-perl/ | 2020-06-21 07:18 | - | |
![[DIR]](/icons/folder.gif) | libdevice-serialport-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdevice-usb-pcsensor-hidtemper-perl/ | 2024-12-01 15:42 | - | |
![[DIR]](/icons/folder.gif) | libdevice-usb-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdex/ | 2024-09-18 09:05 | - | |
![[DIR]](/icons/folder.gif) | libdexx-java/ | 2021-10-19 17:51 | - | |
![[DIR]](/icons/folder.gif) | libdfp/ | 2024-04-03 21:19 | - | |
![[DIR]](/icons/folder.gif) | libdfu-ahp/ | 2023-01-26 13:36 | - | |
![[DIR]](/icons/folder.gif) | libdfx/ | 2025-02-07 19:08 | - | |
![[DIR]](/icons/folder.gif) | libdigest-bcrypt-perl/ | 2022-01-23 06:29 | - | |
![[DIR]](/icons/folder.gif) | libdigest-bubblebabble-perl/ | 2018-05-17 15:29 | - | |
![[DIR]](/icons/folder.gif) | libdigest-crc-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-elf-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-jhash-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-md2-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-md4-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-md5-file-perl/ | 2021-01-02 00:42 | - | |
![[DIR]](/icons/folder.gif) | libdigest-murmurhash3-pureperl-perl/ | 2023-02-05 05:09 | - | |
![[DIR]](/icons/folder.gif) | libdigest-perl-md5-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdigest-perl/ | 2016-11-01 02:13 | - | |
![[DIR]](/icons/folder.gif) | libdigest-sha-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-sha3-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-ssdeep-perl/ | 2021-01-01 18:34 | - | |
![[DIR]](/icons/folder.gif) | libdigest-whirlpool-perl/ | 2024-12-11 13:59 | - | |
![[DIR]](/icons/folder.gif) | libdigidoc/ | 2024-08-23 15:01 | - | |
![[DIR]](/icons/folder.gif) | libdigidocpp/ | 2018-11-09 07:17 | - | |
![[DIR]](/icons/folder.gif) | libdime-tools-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdir-purge-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdir-self-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdirectory-scratch-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdirectory-scratch-structured-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdisasm/ | 2025-03-05 14:52 | - | |
![[DIR]](/icons/folder.gif) | libdiscid/ | 2024-04-19 00:28 | - | |
![[DIR]](/icons/folder.gif) | libdisorder/ | 2024-04-22 12:51 | - | |
![[DIR]](/icons/folder.gif) | libdispatch-class-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdispatch/ | 2015-04-26 20:02 | - | |
![[DIR]](/icons/folder.gif) | libdisplay-info/ | 2024-08-07 15:55 | - | |
![[DIR]](/icons/folder.gif) | libdisplaymigration/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdist-build-perl/ | 2024-10-26 10:10 | - | |
![[DIR]](/icons/folder.gif) | libdist-checkconflicts-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-doap-perl/ | 2020-07-13 10:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-profile-tobyink-perl/ | 2024-03-05 18:48 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-role-git-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-role-hg-perl/ | 2024-03-05 18:48 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-role-release-perl/ | 2024-03-05 18:48 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-role-test-kwalitee-perl/ | 2024-03-05 06:38 | - | |
![[DIR]](/icons/folder.gif) | libdist-inkt-role-test-perl/ | 2024-03-06 00:33 | - | |
![[DIR]](/icons/folder.gif) | libdist-metadata-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-app-command-authordebs-perl/ | 2023-12-16 00:57 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-app-command-cover-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-config-slicer-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-localetextdomain-perl/ | 2025-02-19 01:22 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-perl/ | 2024-05-26 14:02 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-autometaresources-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-bootstrap-lib-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-bugtracker-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-changelogfromgit-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-checkbin-perl/ | 2022-06-14 02:18 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-checkextratests-perl/ | 2022-12-07 01:03 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-config-git-perl/ | 2022-06-19 14:19 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-emailnotify-perl/ | 2022-06-16 02:21 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-git-perl/ | 2024-06-22 08:32 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-githubmeta-perl/ | 2022-11-20 19:05 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-installguide-perl/ | 2022-05-28 19:59 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-localemsgfmt-perl/ | 2018-11-09 11:54 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-makemaker-awesome-perl/ | 2021-10-19 04:29 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-makemaker-fallback-perl/ | 2024-12-08 07:32 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-metaprovides-package-perl/ | 2022-11-06 05:02 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-metaprovides-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-minimumperlfast-perl/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-modulebuildtiny-fallback-perl/ | 2022-05-16 08:20 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-modulebuildtiny-perl/ | 2023-10-27 08:53 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-mojibaketests-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-ourpkgversion-perl/ | 2022-11-21 00:51 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-podspellingtests-perl/ | 2015-04-26 14:11 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-podweaver-perl/ | 2023-01-15 06:44 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-prepender-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-readmefrompod-perl/ | 2023-10-27 08:53 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-repository-perl/ | 2022-11-20 06:36 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-requiresexternal-perl/ | 2021-02-21 19:16 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-run-perl/ | 2024-06-08 08:03 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-signature-perl/ | 2021-12-06 13:15 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-templatefiles-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-compile-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-eol-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-kwalitee-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-notabs-perl/ | 2022-12-13 13:03 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-perl-critic-perl/ | 2024-11-16 07:01 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-podspelling-perl/ | 2024-11-16 07:01 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-test-reportprereqs-perl/ | 2023-01-15 06:44 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugin-twitter-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-plugins-cjm-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-role-bootstrap-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-role-modulemetadata-perl/ | 2022-12-05 06:39 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-role-pluginbundle-pluginremover-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-util-configdumper-perl/ | 2024-01-11 02:10 | - | |
![[DIR]](/icons/folder.gif) | libdist-zilla-util-test-kentnl-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdistlib-java/ | 2024-05-18 07:58 | - | |
![[DIR]](/icons/folder.gif) | libdivecomputer/ | 2020-07-10 23:52 | - | |
![[DIR]](/icons/folder.gif) | libdivide/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdivsufsort/ | 2024-02-15 21:18 | - | |
![[DIR]](/icons/folder.gif) | libdjconsole/ | 2024-05-25 19:54 | - | |
![[DIR]](/icons/folder.gif) | libdjinterop/ | 2024-11-01 15:32 | - | |
![[DIR]](/icons/folder.gif) | libdkim/ | 2024-04-05 09:45 | - | |
![[DIR]](/icons/folder.gif) | libdlna/ | 2022-09-22 08:34 | - | |
![[DIR]](/icons/folder.gif) | libdmapsharing/ | 2024-11-16 11:50 | - | |
![[DIR]](/icons/folder.gif) | libdmtx/ | 2024-04-04 21:15 | - | |
![[DIR]](/icons/folder.gif) | libdnf/ | 2025-03-10 14:31 | - | |
![[DIR]](/icons/folder.gif) | libdng/ | 2025-02-11 12:26 | - | |
![[DIR]](/icons/folder.gif) | libdns-zoneparse-perl/ | 2021-01-06 00:56 | - | |
![[DIR]](/icons/folder.gif) | libdockapp/ | 2024-11-01 15:32 | - | |
![[DIR]](/icons/folder.gif) | libdogleg/ | 2023-11-23 18:20 | - | |
![[DIR]](/icons/folder.gif) | libdomain-publicsuffix-perl/ | 2024-12-08 07:32 | - | |
![[DIR]](/icons/folder.gif) | libdontdie/ | 2022-12-07 19:51 | - | |
![[DIR]](/icons/folder.gif) | libdoxygen-filter-perl/ | 2023-06-12 20:48 | - | |
![[DIR]](/icons/folder.gif) | libdpkg-log-perl/ | 2011-05-04 23:11 | - | |
![[DIR]](/icons/folder.gif) | libdpkg-parse-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdr-sundown-perl/ | 2024-10-20 13:34 | - | |
![[DIR]](/icons/folder.gif) | libdr-tarantool-perl/ | 2020-12-30 00:34 | - | |
![[DIR]](/icons/folder.gif) | libdri2/ | 2022-02-11 01:20 | - | |
![[DIR]](/icons/folder.gif) | libdrilbo/ | 2021-01-04 01:28 | - | |
![[DIR]](/icons/folder.gif) | libdrm/ | 2024-11-20 08:46 | - | |
![[DIR]](/icons/folder.gif) | libdrpm/ | 2024-12-30 08:35 | - | |
![[DIR]](/icons/folder.gif) | libdrumstick/ | 2025-01-02 07:48 | - | |
![[DIR]](/icons/folder.gif) | libdshconfig/ | 2025-02-02 20:42 | - | |
![[DIR]](/icons/folder.gif) | libdsiutils-java/ | 2023-06-19 07:59 | - | |
![[DIR]](/icons/folder.gif) | libdsk/ | 2024-04-22 13:49 | - | |
![[DIR]](/icons/folder.gif) | libdsme/ | 2015-12-04 10:23 | - | |
![[DIR]](/icons/folder.gif) | libdssialsacompat/ | 2024-04-06 15:48 | - | |
![[DIR]](/icons/folder.gif) | libdtdparser-java/ | 2016-10-31 19:28 | - | |
![[DIR]](/icons/folder.gif) | libdublincore-record-perl/ | 2022-06-14 07:50 | - | |
![[DIR]](/icons/folder.gif) | libdumb/ | 2024-12-18 07:30 | - | |
![[DIR]](/icons/folder.gif) | libdumbnet/ | 2025-03-10 04:18 | - | |
![[DIR]](/icons/folder.gif) | libdumbtts/ | 2022-07-24 05:42 | - | |
![[DIR]](/icons/folder.gif) | libdv/ | 2024-04-13 08:50 | - | |
![[DIR]](/icons/folder.gif) | libdvb/ | 2016-10-31 19:28 | - | |
![[DIR]](/icons/folder.gif) | libdvbcsa/ | 2022-04-30 08:51 | - | |
![[DIR]](/icons/folder.gif) | libdvbpsi/ | 2024-04-19 00:28 | - | |
![[DIR]](/icons/folder.gif) | libdvdnav/ | 2024-04-04 21:15 | - | |
![[DIR]](/icons/folder.gif) | libdvdread/ | 2024-11-01 15:32 | - | |
![[DIR]](/icons/folder.gif) | libdynaloader-functions-perl/ | 2018-01-11 18:19 | - | |
![[DIR]](/icons/folder.gif) | libdynapath-clojure/ | 2020-07-10 23:51 | - | |
|
Its updates are not triggered by a push, hence the mirror may be
out of date. If you want to use it, we suggest to use it like this
(you can also use HTTP instead of HTTPS if you want):
So if this security mirror already has the updated package
mirrored, it's fetched from there as it's the first hit for the newest
version. If not, the newest package is still already available and
fetched from the official servers.